C23H25NO8 — CID 13019334
(E)-3-[5-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-nitrophenyl]prop-2-enoic acid (PubChem CID 13019334) has the molecular formula C23H25NO8 and a molecular weight of 443.45 g/mol. Its IUPAC name is (E)-3-[5-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-nitrophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-nitrophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 13019334 |
| Molecular Formula | C23H25NO8 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (E)-3-[5-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-nitrophenyl]prop-2-enoic acid |
| SMILES | CCCc1c(OCCCOc2ccc([N+](=O)[O-])c(/C=C/C(=O)O)c2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H25NO8/c1-3-5-19-21(10-8-18(15(2)25)23(19)28)32-13-4-12-31-17-7-9-20(24(29)30)16(14-17)6-11-22(26)27/h6-11,14,28H,3-5,12-13H2,1-2H3,(H,26,27)/b11-6+ |
| InChIKey | PYSKWNUWAJCELS-IZZDOVSWSA-N |
| XLogP | 4.40 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|