C29H31NaO9 — CID 23720716
sodium (E)-3-[7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-oxo-8-propylchromen-2-yl]prop-2-enoate (PubChem CID 23720716) has the molecular formula C29H31NaO9 and a molecular weight of 546.55 g/mol. Its IUPAC name is sodium (E)-3-[7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-oxo-8-propylchromen-2-yl]prop-2-enoate.
| Compound Name | sodium (E)-3-[7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-oxo-8-propylchromen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 23720716 |
| Molecular Formula | C29H31NaO9 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | sodium (E)-3-[7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-oxo-8-propylchromen-2-yl]prop-2-enoate |
| SMILES | CCCc1c(OCC(O)COc2ccc3c(=O)cc(/C=C/C(=O)[O-])oc3c2CCC)ccc(C(C)=O)c1O.[Na+] |
| InChI | InChI=1S/C29H32O9.Na/c1-4-6-22-25(11-9-20(17(3)30)28(22)35)36-15-18(31)16-37-26-12-10-21-24(32)14-19(8-13-27(33)34)38-29(21)23(26)7-5-2;/h8-14,18,31,35H,4-7,15-16H2,1-3H3,(H,33,34);/q;+1/p-1/b13-8+; |
| InChIKey | KFQHELQWEZAJOV-FNXZNAJJSA-M |
| XLogP | 0.19 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|