C23H23NO10 — CID 54686039
6-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-hydroxy-3-nitrochromen-2-one (PubChem CID 54686039) has the molecular formula C23H23NO10 and a molecular weight of 473.43 g/mol. Its IUPAC name is 6-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-hydroxy-3-nitrochromen-2-one.
| Compound Name | 6-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-hydroxy-3-nitrochromen-2-one |
|---|---|
| PubChem CID | 54686039 |
| Molecular Formula | C23H23NO10 |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 6-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-hydroxy-3-nitrochromen-2-one |
| SMILES | CCCc1c(OCC(O)COc2ccc3oc(=O)c([N+](=O)[O-])c(O)c3c2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H23NO10/c1-3-4-16-18(8-6-15(12(2)25)21(16)27)33-11-13(26)10-32-14-5-7-19-17(9-14)22(28)20(24(30)31)23(29)34-19/h5-9,13,26-28H,3-4,10-11H2,1-2H3 |
| InChIKey | GWUHOBKLEBYAQP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 169.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|