C24H21NaO9 — CID 23662021
sodium 7-[3-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate (PubChem CID 23662021) has the molecular formula C24H21NaO9 and a molecular weight of 476.41 g/mol. Its IUPAC name is sodium 7-[3-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate.
| Compound Name | sodium 7-[3-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 23662021 |
| Molecular Formula | C24H21NaO9 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | sodium 7-[3-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate |
| SMILES | C=CCc1c(OCC(O)COc2ccc3c(=O)cc(C(=O)[O-])oc3c2)ccc(C(C)=O)c1O.[Na+] |
| InChI | InChI=1S/C24H22O9.Na/c1-3-4-18-20(8-7-16(13(2)25)23(18)28)32-12-14(26)11-31-15-5-6-17-19(27)10-22(24(29)30)33-21(17)9-15;/h3,5-10,14,26,28H,1,4,11-12H2,2H3,(H,29,30);/q;+1/p-1 |
| InChIKey | FIFXQSUFUJWNJI-UHFFFAOYSA-M |
| XLogP | -1.38 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|