C17H22O6S — CID 57114050
6-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-5-hydroxy-3-sulfanylhexanoic acid (PubChem CID 57114050) has the molecular formula C17H22O6S and a molecular weight of 354.42 g/mol. Its IUPAC name is 6-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-5-hydroxy-3-sulfanylhexanoic acid.
| Compound Name | 6-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-5-hydroxy-3-sulfanylhexanoic acid |
|---|---|
| PubChem CID | 57114050 |
| Molecular Formula | C17H22O6S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 6-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-5-hydroxy-3-sulfanylhexanoic acid |
| SMILES | C=CCc1c(OCC(O)CC(S)CC(=O)O)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C17H22O6S/c1-3-4-14-15(6-5-13(10(2)18)17(14)22)23-9-11(19)7-12(24)8-16(20)21/h3,5-6,11-12,19,22,24H,1,4,7-9H2,2H3,(H,20,21) |
| InChIKey | HOAJYIMAQNMUOY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|