C17H21NO3S — CID 57314039
6-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-3-sulfanylhexanenitrile (PubChem CID 57314039) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 6-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-3-sulfanylhexanenitrile.
| Compound Name | 6-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-3-sulfanylhexanenitrile |
|---|---|
| PubChem CID | 57314039 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 6-(4-acetyl-3-hydroxy-2-prop-2-enylphenoxy)-3-sulfanylhexanenitrile |
| SMILES | C=CCc1c(OCCCC(S)CC#N)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C17H21NO3S/c1-3-5-15-16(8-7-14(12(2)19)17(15)20)21-11-4-6-13(22)9-10-18/h3,7-8,13,20,22H,1,4-6,9,11H2,2H3 |
| InChIKey | PNHXZPNNUYWSPK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|