C21H21NO3 — CID 13458140
4-[(E)-3-(4-acetyl-3-hydroxy-2-propylphenoxy)prop-1-enyl]benzonitrile (PubChem CID 13458140) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-[(E)-3-(4-acetyl-3-hydroxy-2-propylphenoxy)prop-1-enyl]benzonitrile.
| Compound Name | 4-[(E)-3-(4-acetyl-3-hydroxy-2-propylphenoxy)prop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 13458140 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4-[(E)-3-(4-acetyl-3-hydroxy-2-propylphenoxy)prop-1-enyl]benzonitrile |
| SMILES | CCCc1c(OC/C=C/c2ccc(C#N)cc2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C21H21NO3/c1-3-5-19-20(12-11-18(15(2)23)21(19)24)25-13-4-6-16-7-9-17(14-22)10-8-16/h4,6-12,24H,3,5,13H2,1-2H3/b6-4+ |
| InChIKey | WPPVXUGJRACFMX-GQCTYLIASA-N |
| XLogP | 4.51 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |