C24H22N2O4 — CID 59599579
6-[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenoxy]pyridine-3-carbonitrile (PubChem CID 59599579) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 6-[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenoxy]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenoxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59599579 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 6-[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenoxy]pyridine-3-carbonitrile |
| SMILES | CCCc1c(OCc2ccc(Oc3ccc(C#N)cn3)cc2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C24H22N2O4/c1-3-4-21-22(11-10-20(16(2)27)24(21)28)29-15-17-5-8-19(9-6-17)30-23-12-7-18(13-25)14-26-23/h5-12,14,28H,3-4,15H2,1-2H3 |
| InChIKey | UISRUNHEDSTYBZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |