C22H25NO3S — CID 13368612
3-[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]propyl thiocyanate (PubChem CID 13368612) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is 3-[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]propyl thiocyanate.
| Compound Name | 3-[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]propyl thiocyanate |
|---|---|
| PubChem CID | 13368612 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]propyl thiocyanate |
| SMILES | CCCc1c(OCc2ccc(CCCSC#N)cc2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C22H25NO3S/c1-3-5-20-21(12-11-19(16(2)24)22(20)25)26-14-18-9-7-17(8-10-18)6-4-13-27-15-23/h7-12,25H,3-6,13-14H2,1-2H3 |
| InChIKey | SFORRWHKZHOIFM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|