C25H25NO7S — CID 11620001
4-[[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]sulfonylamino]benzoic acid (PubChem CID 11620001) has the molecular formula C25H25NO7S and a molecular weight of 483.54 g/mol. Its IUPAC name is 4-[[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]sulfonylamino]benzoic acid.
| Compound Name | 4-[[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 11620001 |
| Molecular Formula | C25H25NO7S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 4-[[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]sulfonylamino]benzoic acid |
| SMILES | CCCc1c(OCc2ccc(S(=O)(=O)Nc3ccc(C(=O)O)cc3)cc2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C25H25NO7S/c1-3-4-22-23(14-13-21(16(2)27)24(22)28)33-15-17-5-11-20(12-6-17)34(31,32)26-19-9-7-18(8-10-19)25(29)30/h5-14,26,28H,3-4,15H2,1-2H3,(H,29,30) |
| InChIKey | UCLCJSCESUIHFI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |