C19H20O5 — CID 15682696
4-[(4-acetyl-3-hydroxy-2-propylphenyl)methoxy]benzoic acid (PubChem CID 15682696) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is 4-[(4-acetyl-3-hydroxy-2-propylphenyl)methoxy]benzoic acid.
| Compound Name | 4-[(4-acetyl-3-hydroxy-2-propylphenyl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 15682696 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 4-[(4-acetyl-3-hydroxy-2-propylphenyl)methoxy]benzoic acid |
| SMILES | CCCc1c(COc2ccc(C(=O)O)cc2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C19H20O5/c1-3-4-17-14(7-10-16(12(2)20)18(17)21)11-24-15-8-5-13(6-9-15)19(22)23/h5-10,21H,3-4,11H2,1-2H3,(H,22,23) |
| InChIKey | UIXCPOKUKJARLI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |