C23H25NO4 — CID 15098201
5-[4-[(4-acetyl-3-hydroxy-2-propylphenyl)methoxy]phenyl]-5-oxopentanenitrile (PubChem CID 15098201) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 5-[4-[(4-acetyl-3-hydroxy-2-propylphenyl)methoxy]phenyl]-5-oxopentanenitrile.
| Compound Name | 5-[4-[(4-acetyl-3-hydroxy-2-propylphenyl)methoxy]phenyl]-5-oxopentanenitrile |
|---|---|
| PubChem CID | 15098201 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 5-[4-[(4-acetyl-3-hydroxy-2-propylphenyl)methoxy]phenyl]-5-oxopentanenitrile |
| SMILES | CCCc1c(COc2ccc(C(=O)CCCC#N)cc2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H25NO4/c1-3-6-21-18(10-13-20(16(2)25)23(21)27)15-28-19-11-8-17(9-12-19)22(26)7-4-5-14-24/h8-13,27H,3-7,15H2,1-2H3 |
| InChIKey | DLOPCPIYFYGGKH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|