C16H24O4 — CID 15682684
1-[2-hydroxy-4-(4-hydroxybutoxymethyl)-3-propylphenyl]ethanone (PubChem CID 15682684) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-[2-hydroxy-4-(4-hydroxybutoxymethyl)-3-propylphenyl]ethanone.
| Compound Name | 1-[2-hydroxy-4-(4-hydroxybutoxymethyl)-3-propylphenyl]ethanone |
|---|---|
| PubChem CID | 15682684 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[2-hydroxy-4-(4-hydroxybutoxymethyl)-3-propylphenyl]ethanone |
| SMILES | CCCc1c(COCCCCO)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C16H24O4/c1-3-6-15-13(11-20-10-5-4-9-17)7-8-14(12(2)18)16(15)19/h7-8,17,19H,3-6,9-11H2,1-2H3 |
| InChIKey | ZTQSPUVAQRBUAZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|