C18H26N4O3 — CID 70351097
1-[2-hydroxy-3-propyl-4-[5-(2H-tetrazol-5-yl)pentoxymethyl]phenyl]ethanone (PubChem CID 70351097) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[2-hydroxy-3-propyl-4-[5-(2H-tetrazol-5-yl)pentoxymethyl]phenyl]ethanone.
| Compound Name | 1-[2-hydroxy-3-propyl-4-[5-(2H-tetrazol-5-yl)pentoxymethyl]phenyl]ethanone |
|---|---|
| PubChem CID | 70351097 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[2-hydroxy-3-propyl-4-[5-(2H-tetrazol-5-yl)pentoxymethyl]phenyl]ethanone |
| SMILES | CCCc1c(COCCCCCc2nn[nH]n2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C18H26N4O3/c1-3-7-16-14(9-10-15(13(2)23)18(16)24)12-25-11-6-4-5-8-17-19-21-22-20-17/h9-10,24H,3-8,11-12H2,1-2H3,(H,19,20,21,22) |
| InChIKey | MQUSSRVXDPUQJR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|