About CID 67864129
CID 67864129 (PubChem CID 67864129) has the molecular formula C26H32N8NaO3
and a molecular weight of 527.59 g/mol.
Molecular Properties
| Compound Name | CID 67864129 |
| PubChem CID | 67864129 |
| Molecular Formula | C26H32N8NaO3 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | — |
| SMILES | CCCc1c(COc2ccc(Cc3nnn(CCCCCc4nn[nH]n4)n3)cc2)ccc(C(C)=O)c1O.[Na] |
| InChI | InChI=1S/C26H32N8O3.Na/c1-3-7-23-20(11-14-22(18(2)35)26(23)36)17-37-21-12-9-19(10-13-21)16-25-29-33-34(30-25)15-6-4-5-8-24-27-31-32-28-24;/h9-14,36H,3-8,15-17H2,1-2H3,(H,27,28,31,32); |
| InChIKey | VKVGIXBXWJSXCH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 67864129 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67864129?
The IUPAC name of CID 67864129 (CID 67864129) is not available.
What is the SMILES notation for CID 67864129?
The canonical SMILES for CID 67864129 is CCCc1c(COc2ccc(Cc3nnn(CCCCCc4nn[nH]n4)n3)cc2)ccc(C(C)=O)c1O.[Na].
What is the InChIKey of CID 67864129?
The InChIKey is VKVGIXBXWJSXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N8O3.Na/c1-3-7-23-20(11-14-22(18(2)35)26(23)36)17-37-21-12-9-19(10-13-21)16-25-29-33-34(30-25)15-6-4-5-8-24-27-31-32-28-24;/h9-14,36H,3-8,15-17H2,1-2H3,(H,27,28,31,32);.
What are the key properties of CID 67864129?
CID 67864129 has a molecular weight of 527.59 g/mol, XLogP of 3.25, 14 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67864129 is sourced from PubChem (CID 67864129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).