C26H32N8NaO3 — CID 67864129
CID 67864129 (PubChem CID 67864129) has the molecular formula C26H32N8NaO3 and a molecular weight of 527.59 g/mol.
| Compound Name | CID 67864129 |
|---|---|
| PubChem CID | 67864129 |
| Molecular Formula | C26H32N8NaO3 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | — |
| SMILES | CCCc1c(COc2ccc(Cc3nnn(CCCCCc4nn[nH]n4)n3)cc2)ccc(C(C)=O)c1O.[Na] |
| InChI | InChI=1S/C26H32N8O3.Na/c1-3-7-23-20(11-14-22(18(2)35)26(23)36)17-37-21-12-9-19(10-13-21)16-25-29-33-34(30-25)15-6-4-5-8-24-27-31-32-28-24;/h9-14,36H,3-8,15-17H2,1-2H3,(H,27,28,31,32); |
| InChIKey | VKVGIXBXWJSXCH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|