C22H32N4O5 — CID 15614875
6-[5-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butyl]tetrazol-2-yl]hexanoic acid (PubChem CID 15614875) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 6-[5-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butyl]tetrazol-2-yl]hexanoic acid.
| Compound Name | 6-[5-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butyl]tetrazol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 15614875 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 6-[5-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butyl]tetrazol-2-yl]hexanoic acid |
| SMILES | CCCc1c(OCCCCc2nnn(CCCCCC(=O)O)n2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C22H32N4O5/c1-3-9-18-19(13-12-17(16(2)27)22(18)30)31-15-8-6-10-20-23-25-26(24-20)14-7-4-5-11-21(28)29/h12-13,30H,3-11,14-15H2,1-2H3,(H,28,29) |
| InChIKey | AQRLDNZUIYNWRM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|