C23H34N8O3 — CID 15614924
1-[2-hydroxy-3-propyl-4-[6-[1-[4-(2H-tetrazol-5-yl)butyl]tetrazol-5-yl]hexoxy]phenyl]ethanone (PubChem CID 15614924) has the molecular formula C23H34N8O3 and a molecular weight of 470.58 g/mol. Its IUPAC name is 1-[2-hydroxy-3-propyl-4-[6-[1-[4-(2H-tetrazol-5-yl)butyl]tetrazol-5-yl]hexoxy]phenyl]ethanone.
| Compound Name | 1-[2-hydroxy-3-propyl-4-[6-[1-[4-(2H-tetrazol-5-yl)butyl]tetrazol-5-yl]hexoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 15614924 |
| Molecular Formula | C23H34N8O3 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 1-[2-hydroxy-3-propyl-4-[6-[1-[4-(2H-tetrazol-5-yl)butyl]tetrazol-5-yl]hexoxy]phenyl]ethanone |
| SMILES | CCCc1c(OCCCCCCc2nnnn2CCCCc2nn[nH]n2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H34N8O3/c1-3-10-19-20(14-13-18(17(2)32)23(19)33)34-16-9-5-4-6-12-22-26-29-30-31(22)15-8-7-11-21-24-27-28-25-21/h13-14,33H,3-12,15-16H2,1-2H3,(H,24,25,27,28) |
| InChIKey | DVVMIQWYHQJVBR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|