C23H33N5O3 — CID 15614920
5-[5-[6-(4-acetyl-3-hydroxy-2-propylphenoxy)hexyl]tetrazol-1-yl]pentanenitrile (PubChem CID 15614920) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is 5-[5-[6-(4-acetyl-3-hydroxy-2-propylphenoxy)hexyl]tetrazol-1-yl]pentanenitrile.
| Compound Name | 5-[5-[6-(4-acetyl-3-hydroxy-2-propylphenoxy)hexyl]tetrazol-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 15614920 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 5-[5-[6-(4-acetyl-3-hydroxy-2-propylphenoxy)hexyl]tetrazol-1-yl]pentanenitrile |
| SMILES | CCCc1c(OCCCCCCc2nnnn2CCCCC#N)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H33N5O3/c1-3-11-20-21(14-13-19(18(2)29)23(20)30)31-17-10-5-4-7-12-22-25-26-27-28(22)16-9-6-8-15-24/h13-14,30H,3-12,16-17H2,1-2H3 |
| InChIKey | XGKMDSRLBUHSNW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|