C13H16O3 — CID 20590669
1-[3-(methoxymethoxy)-2-prop-2-enylphenyl]ethanone (PubChem CID 20590669) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-[3-(methoxymethoxy)-2-prop-2-enylphenyl]ethanone.
| Compound Name | 1-[3-(methoxymethoxy)-2-prop-2-enylphenyl]ethanone |
|---|---|
| PubChem CID | 20590669 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1-[3-(methoxymethoxy)-2-prop-2-enylphenyl]ethanone |
| SMILES | C=CCc1c(OCOC)cccc1C(C)=O |
| InChI | InChI=1S/C13H16O3/c1-4-6-12-11(10(2)14)7-5-8-13(12)16-9-15-3/h4-5,7-8H,1,6,9H2,2-3H3 |
| InChIKey | FDVOTLMRQBKRIS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|