C11H12N2O2 — CID 67682969
2-prop-2-enylbenzene-1,3-dicarboxamide (PubChem CID 67682969) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-prop-2-enylbenzene-1,3-dicarboxamide.
| Compound Name | 2-prop-2-enylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 67682969 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-prop-2-enylbenzene-1,3-dicarboxamide |
| SMILES | C=CCc1c(C(N)=O)cccc1C(N)=O |
| InChI | InChI=1S/C11H12N2O2/c1-2-4-7-8(10(12)14)5-3-6-9(7)11(13)15/h2-3,5-6H,1,4H2,(H2,12,14)(H2,13,15) |
| InChIKey | UKLXCBXSYQXTGP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|