C12H15NO — CID 141019627
2-but-3-enyl-3-methylbenzamide (PubChem CID 141019627) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-but-3-enyl-3-methylbenzamide.
| Compound Name | 2-but-3-enyl-3-methylbenzamide |
|---|---|
| PubChem CID | 141019627 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-but-3-enyl-3-methylbenzamide |
| SMILES | C=CCCc1c(C)cccc1C(N)=O |
| InChI | InChI=1S/C12H15NO/c1-3-4-7-10-9(2)6-5-8-11(10)12(13)14/h3,5-6,8H,1,4,7H2,2H3,(H2,13,14) |
| InChIKey | GFXRQDTYIVAAGF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|