C12H15NO3 — CID 57160384
2,4-bis(hydroxymethyl)-3-prop-2-enylbenzamide (PubChem CID 57160384) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2,4-bis(hydroxymethyl)-3-prop-2-enylbenzamide.
| Compound Name | 2,4-bis(hydroxymethyl)-3-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 57160384 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2,4-bis(hydroxymethyl)-3-prop-2-enylbenzamide |
| SMILES | C=CCc1c(CO)ccc(C(N)=O)c1CO |
| InChI | InChI=1S/C12H15NO3/c1-2-3-9-8(6-14)4-5-10(12(13)16)11(9)7-15/h2,4-5,14-15H,1,3,6-7H2,(H2,13,16) |
| InChIKey | MEOHCNNRHOKFPR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|