C22H26O5 — CID 173437645
[3-[2,3-bis(hydroxymethyl)-4-prop-2-enylphenoxy]-2-(hydroxymethyl)-6-prop-2-enylphenyl]methanol (PubChem CID 173437645) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is [3-[2,3-bis(hydroxymethyl)-4-prop-2-enylphenoxy]-2-(hydroxymethyl)-6-prop-2-enylphenyl]methanol.
| Compound Name | [3-[2,3-bis(hydroxymethyl)-4-prop-2-enylphenoxy]-2-(hydroxymethyl)-6-prop-2-enylphenyl]methanol |
|---|---|
| PubChem CID | 173437645 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [3-[2,3-bis(hydroxymethyl)-4-prop-2-enylphenoxy]-2-(hydroxymethyl)-6-prop-2-enylphenyl]methanol |
| SMILES | C=CCc1ccc(Oc2ccc(CC=C)c(CO)c2CO)c(CO)c1CO |
| InChI | InChI=1S/C22H26O5/c1-3-5-15-7-9-21(19(13-25)17(15)11-23)27-22-10-8-16(6-4-2)18(12-24)20(22)14-26/h3-4,7-10,23-26H,1-2,5-6,11-14H2 |
| InChIKey | YKKMHVIMHYOAOA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|