C18H14Cl4O — CID 141308545
2,5-dichloro-1-(2,5-dichloro-3-prop-2-enylphenoxy)-3-prop-2-enylbenzene (PubChem CID 141308545) has the molecular formula C18H14Cl4O and a molecular weight of 388.12 g/mol. Its IUPAC name is 2,5-dichloro-1-(2,5-dichloro-3-prop-2-enylphenoxy)-3-prop-2-enylbenzene.
| Compound Name | 2,5-dichloro-1-(2,5-dichloro-3-prop-2-enylphenoxy)-3-prop-2-enylbenzene |
|---|---|
| PubChem CID | 141308545 |
| Molecular Formula | C18H14Cl4O |
| Molecular Weight | 388.12 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 2,5-dichloro-1-(2,5-dichloro-3-prop-2-enylphenoxy)-3-prop-2-enylbenzene |
| SMILES | C=CCc1cc(Cl)cc(Oc2cc(Cl)cc(CC=C)c2Cl)c1Cl |
| InChI | InChI=1S/C18H14Cl4O/c1-3-5-11-7-13(19)9-15(17(11)21)23-16-10-14(20)8-12(6-4-2)18(16)22/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | XXMDVBDCEHQXBH-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.12 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|