C12H12Cl2 — CID 173196213
1,3-dichloro-2,4-bis(prop-2-enyl)benzene (PubChem CID 173196213) has the molecular formula C12H12Cl2 and a molecular weight of 227.13 g/mol. Its IUPAC name is 1,3-dichloro-2,4-bis(prop-2-enyl)benzene.
| Compound Name | 1,3-dichloro-2,4-bis(prop-2-enyl)benzene |
|---|---|
| PubChem CID | 173196213 |
| Molecular Formula | C12H12Cl2 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 1,3-dichloro-2,4-bis(prop-2-enyl)benzene |
| SMILES | C=CCc1ccc(Cl)c(CC=C)c1Cl |
| InChI | InChI=1S/C12H12Cl2/c1-3-5-9-7-8-11(13)10(6-4-2)12(9)14/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | MNEWHFSDMTYQRT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|