About 3-amino-2,6-bis(prop-2-enyl)phenol
3-amino-2,6-bis(prop-2-enyl)phenol (PubChem CID 158258478) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-amino-2,6-bis(prop-2-enyl)phenol.
Molecular Properties
| Compound Name | 3-amino-2,6-bis(prop-2-enyl)phenol |
| PubChem CID | 158258478 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-amino-2,6-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1ccc(N)c(CC=C)c1O |
| InChI | InChI=1S/C12H15NO/c1-3-5-9-7-8-11(13)10(6-4-2)12(9)14/h3-4,7-8,14H,1-2,5-6,13H2 |
| InChIKey | GHORPKYJSATAAS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2,6-bis(prop-2-enyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,6-bis(prop-2-enyl)phenol?
The IUPAC name of 3-amino-2,6-bis(prop-2-enyl)phenol (CID 158258478) is 3-amino-2,6-bis(prop-2-enyl)phenol.
What is the SMILES notation for 3-amino-2,6-bis(prop-2-enyl)phenol?
The canonical SMILES for 3-amino-2,6-bis(prop-2-enyl)phenol is C=CCc1ccc(N)c(CC=C)c1O.
What is the InChIKey of 3-amino-2,6-bis(prop-2-enyl)phenol?
The InChIKey is GHORPKYJSATAAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-3-5-9-7-8-11(13)10(6-4-2)12(9)14/h3-4,7-8,14H,1-2,5-6,13H2.
What are the key properties of 3-amino-2,6-bis(prop-2-enyl)phenol?
3-amino-2,6-bis(prop-2-enyl)phenol has a molecular weight of 189.26 g/mol, XLogP of 2.43, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,6-bis(prop-2-enyl)phenol is sourced from PubChem (CID 158258478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).