C12H15NO — CID 158258478
3-amino-2,6-bis(prop-2-enyl)phenol (PubChem CID 158258478) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-amino-2,6-bis(prop-2-enyl)phenol.
| Compound Name | 3-amino-2,6-bis(prop-2-enyl)phenol |
|---|---|
| PubChem CID | 158258478 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-amino-2,6-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1ccc(N)c(CC=C)c1O |
| InChI | InChI=1S/C12H15NO/c1-3-5-9-7-8-11(13)10(6-4-2)12(9)14/h3-4,7-8,14H,1-2,5-6,13H2 |
| InChIKey | GHORPKYJSATAAS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|