C24H28O4 — CID 157436892
3,4-bis(prop-2-enyl)benzene-1,2-diol;4,5-bis(prop-2-enyl)benzene-1,2-diol (PubChem CID 157436892) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is 3,4-bis(prop-2-enyl)benzene-1,2-diol;4,5-bis(prop-2-enyl)benzene-1,2-diol.
| Compound Name | 3,4-bis(prop-2-enyl)benzene-1,2-diol;4,5-bis(prop-2-enyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 157436892 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 3,4-bis(prop-2-enyl)benzene-1,2-diol;4,5-bis(prop-2-enyl)benzene-1,2-diol |
| SMILES | C=CCc1cc(O)c(O)cc1CC=C.C=CCc1ccc(O)c(O)c1CC=C |
| InChI | InChI=1S/2C12H14O2/c1-3-5-9-7-11(13)12(14)8-10(9)6-4-2;1-3-5-9-7-8-11(13)12(14)10(9)6-4-2/h2*3-4,7-8,13-14H,1-2,5-6H2 |
| InChIKey | BRFDNVTVORAWFQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|