About CID 144998768
CID 144998768 (PubChem CID 144998768) has the molecular formula C9H9BO2
and a molecular weight of 159.98 g/mol.
Molecular Properties
| Compound Name | CID 144998768 |
| PubChem CID | 144998768 |
| Molecular Formula | C9H9BO2 |
| Molecular Weight | 159.98 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(O)c(CC=C)c1O |
| InChI | InChI=1S/C9H9BO2/c1-2-3-6-8(11)5-4-7(10)9(6)12/h2,4-5,11-12H,1,3H2 |
| InChIKey | GQJODVWCVHXCEY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.98 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 144998768 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144998768?
The IUPAC name of CID 144998768 (CID 144998768) is not available.
What is the SMILES notation for CID 144998768?
The canonical SMILES for CID 144998768 is [B]c1ccc(O)c(CC=C)c1O.
What is the InChIKey of CID 144998768?
The InChIKey is GQJODVWCVHXCEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BO2/c1-2-3-6-8(11)5-4-7(10)9(6)12/h2,4-5,11-12H,1,3H2.
What are the key properties of CID 144998768?
CID 144998768 has a molecular weight of 159.98 g/mol, XLogP of 0.62, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144998768 is sourced from PubChem (CID 144998768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).