C18H18O4S — CID 22283889
4-(4-hydroxyphenyl)sulfonyl-2,3-bis(prop-2-enyl)phenol (PubChem CID 22283889) has the molecular formula C18H18O4S and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)sulfonyl-2,3-bis(prop-2-enyl)phenol.
| Compound Name | 4-(4-hydroxyphenyl)sulfonyl-2,3-bis(prop-2-enyl)phenol |
|---|---|
| PubChem CID | 22283889 |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4-(4-hydroxyphenyl)sulfonyl-2,3-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1c(O)ccc(S(=O)(=O)c2ccc(O)cc2)c1CC=C |
| InChI | InChI=1S/C18H18O4S/c1-3-5-15-16(6-4-2)18(12-11-17(15)20)23(21,22)14-9-7-13(19)8-10-14/h3-4,7-12,19-20H,1-2,5-6H2 |
| InChIKey | QTZJCRPTVVCRBZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|