C16H16O4S — CID 67627548
2-but-2-enyl-4-(4-hydroxyphenyl)sulfonylphenol (PubChem CID 67627548) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-but-2-enyl-4-(4-hydroxyphenyl)sulfonylphenol.
| Compound Name | 2-but-2-enyl-4-(4-hydroxyphenyl)sulfonylphenol |
|---|---|
| PubChem CID | 67627548 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-but-2-enyl-4-(4-hydroxyphenyl)sulfonylphenol |
| SMILES | CC=CCc1cc(S(=O)(=O)c2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C16H16O4S/c1-2-3-4-12-11-15(9-10-16(12)18)21(19,20)14-7-5-13(17)6-8-14/h2-3,5-11,17-18H,4H2,1H3 |
| InChIKey | ZCISILFCQQCXTO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|