C16H18O3S — CID 71331194
4-(2,4-diethylphenyl)sulfonylphenol (PubChem CID 71331194) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is 4-(2,4-diethylphenyl)sulfonylphenol.
| Compound Name | 4-(2,4-diethylphenyl)sulfonylphenol |
|---|---|
| PubChem CID | 71331194 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 4-(2,4-diethylphenyl)sulfonylphenol |
| SMILES | CCc1ccc(S(=O)(=O)c2ccc(O)cc2)c(CC)c1 |
| InChI | InChI=1S/C16H18O3S/c1-3-12-5-10-16(13(4-2)11-12)20(18,19)15-8-6-14(17)7-9-15/h5-11,17H,3-4H2,1-2H3 |
| InChIKey | SWIWQDGRHPNSCJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |