C24H34O2S — CID 56983277
1,3,5-triethyl-2-(2,4,6-triethylphenyl)sulfonylbenzene (PubChem CID 56983277) has the molecular formula C24H34O2S and a molecular weight of 386.60 g/mol. Its IUPAC name is 1,3,5-triethyl-2-(2,4,6-triethylphenyl)sulfonylbenzene.
| Compound Name | 1,3,5-triethyl-2-(2,4,6-triethylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 56983277 |
| Molecular Formula | C24H34O2S |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 1,3,5-triethyl-2-(2,4,6-triethylphenyl)sulfonylbenzene |
| SMILES | CCc1cc(CC)c(S(=O)(=O)c2c(CC)cc(CC)cc2CC)c(CC)c1 |
| InChI | InChI=1S/C24H34O2S/c1-7-17-13-19(9-3)23(20(10-4)14-17)27(25,26)24-21(11-5)15-18(8-2)16-22(24)12-6/h13-16H,7-12H2,1-6H3 |
| InChIKey | GADFXDWHCDXJEG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |