C13H17IO — CID 139959913
2,4,6-triethylbenzoyl iodide (PubChem CID 139959913) has the molecular formula C13H17IO and a molecular weight of 316.18 g/mol. Its IUPAC name is 2,4,6-triethylbenzoyl iodide.
| Compound Name | 2,4,6-triethylbenzoyl iodide |
|---|---|
| PubChem CID | 139959913 |
| Molecular Formula | C13H17IO |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 2,4,6-triethylbenzoyl iodide |
| SMILES | CCc1cc(CC)c(C(=O)I)c(CC)c1 |
| InChI | InChI=1S/C13H17IO/c1-4-9-7-10(5-2)12(13(14)15)11(6-3)8-9/h7-8H,4-6H2,1-3H3 |
| InChIKey | BLRXAOSZDRECAM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|