C12H17Al+2 — CID 22768319
(2,4,6-triethylphenyl)aluminum(2+) (PubChem CID 22768319) has the molecular formula C12H17Al+2 and a molecular weight of 188.25 g/mol. Its IUPAC name is (2,4,6-triethylphenyl)aluminum(2+).
| Compound Name | (2,4,6-triethylphenyl)aluminum(2+) |
|---|---|
| PubChem CID | 22768319 |
| Molecular Formula | C12H17Al+2 |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | (2,4,6-triethylphenyl)aluminum(2+) |
| SMILES | CCc1cc(CC)c([Al+2])c(CC)c1 |
| InChI | InChI=1S/C12H17.Al/c1-4-10-7-11(5-2)9-12(6-3)8-10;/h7-8H,4-6H2,1-3H3;/q;+2 |
| InChIKey | WTZNJSOWVNOGSW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |