C16H26 — CID 140660512
2-tert-butyl-1,3,5-triethylbenzene (PubChem CID 140660512) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 2-tert-butyl-1,3,5-triethylbenzene.
| Compound Name | 2-tert-butyl-1,3,5-triethylbenzene |
|---|---|
| PubChem CID | 140660512 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 2-tert-butyl-1,3,5-triethylbenzene |
| SMILES | CCc1cc(CC)c(C(C)(C)C)c(CC)c1 |
| InChI | InChI=1S/C16H26/c1-7-12-10-13(8-2)15(16(4,5)6)14(9-3)11-12/h10-11H,7-9H2,1-6H3 |
| InChIKey | WZOBWXRHSNCJFE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |