About 2-tert-butyl-1,3,5-tripropylbenzene
2-tert-butyl-1,3,5-tripropylbenzene (PubChem CID 123952647) has the molecular formula C19H32
and a molecular weight of 260.46 g/mol. Its IUPAC name is 2-tert-butyl-1,3,5-tripropylbenzene.
Molecular Properties
| Compound Name | 2-tert-butyl-1,3,5-tripropylbenzene |
| PubChem CID | 123952647 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 2-tert-butyl-1,3,5-tripropylbenzene |
| SMILES | CCCc1cc(CCC)c(C(C)(C)C)c(CCC)c1 |
| InChI | InChI=1S/C19H32/c1-7-10-15-13-16(11-8-2)18(19(4,5)6)17(14-15)12-9-3/h13-14H,7-12H2,1-6H3 |
| InChIKey | UOOUXRFHQMCTPH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-1,3,5-tripropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,3,5-tripropylbenzene?
The IUPAC name of 2-tert-butyl-1,3,5-tripropylbenzene (CID 123952647) is 2-tert-butyl-1,3,5-tripropylbenzene.
What is the SMILES notation for 2-tert-butyl-1,3,5-tripropylbenzene?
The canonical SMILES for 2-tert-butyl-1,3,5-tripropylbenzene is CCCc1cc(CCC)c(C(C)(C)C)c(CCC)c1.
What is the InChIKey of 2-tert-butyl-1,3,5-tripropylbenzene?
The InChIKey is UOOUXRFHQMCTPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32/c1-7-10-15-13-16(11-8-2)18(19(4,5)6)17(14-15)12-9-3/h13-14H,7-12H2,1-6H3.
What are the key properties of 2-tert-butyl-1,3,5-tripropylbenzene?
2-tert-butyl-1,3,5-tripropylbenzene has a molecular weight of 260.46 g/mol, XLogP of 5.84, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,3,5-tripropylbenzene is sourced from PubChem (CID 123952647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).