C69H132 — CID 140748092
2-tert-butyl-1,5-bis(3,7,11,15-tetramethylhexadecyl)-3-(3,7,11-trimethylhexadecyl)benzene (PubChem CID 140748092) has the molecular formula C69H132 and a molecular weight of 961.81 g/mol. Its IUPAC name is 2-tert-butyl-1,5-bis(3,7,11,15-tetramethylhexadecyl)-3-(3,7,11-trimethylhexadecyl)benzene.
| Compound Name | 2-tert-butyl-1,5-bis(3,7,11,15-tetramethylhexadecyl)-3-(3,7,11-trimethylhexadecyl)benzene |
|---|---|
| PubChem CID | 140748092 |
| Molecular Formula | C69H132 |
| Molecular Weight | 961.81 g/mol |
| Exact Mass | 961.03 |
| IUPAC Name | 2-tert-butyl-1,5-bis(3,7,11,15-tetramethylhexadecyl)-3-(3,7,11-trimethylhexadecyl)benzene |
| SMILES | CCCCCC(C)CCCC(C)CCCC(C)CCc1cc(CCC(C)CCCC(C)CCCC(C)CCCC(C)C)cc(CCC(C)CCCC(C)CCCC(C)CCCC(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C69H132/c1-18-19-20-31-56(6)34-23-37-59(9)41-27-44-63(13)47-50-66-52-65(49-46-62(12)43-26-40-60(10)38-24-35-57(7)32-21-29-54(2)3)53-67(68(66)69(15,16)17)51-48-64(14)45-28-42-61(11)39-25-36-58(8)33-22-30-55(4)5/h52-64H,18-51H2,1-17H3 |
| InChIKey | LXZFPEXAVBXRPL-UHFFFAOYSA-N |
| XLogP | 23.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 45 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.81 |
| LogP ≤ 5 | 23.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|