C22H27F3 — CID 123667290
1,3,5-tripropyl-2-[4-(trifluoromethyl)phenyl]benzene (PubChem CID 123667290) has the molecular formula C22H27F3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1,3,5-tripropyl-2-[4-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,3,5-tripropyl-2-[4-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 123667290 |
| Molecular Formula | C22H27F3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1,3,5-tripropyl-2-[4-(trifluoromethyl)phenyl]benzene |
| SMILES | CCCc1cc(CCC)c(-c2ccc(C(F)(F)F)cc2)c(CCC)c1 |
| InChI | InChI=1S/C22H27F3/c1-4-7-16-14-18(8-5-2)21(19(15-16)9-6-3)17-10-12-20(13-11-17)22(23,24)25/h10-15H,4-9H2,1-3H3 |
| InChIKey | DUTAOEXJTBAKBK-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |