C14H19F3 — CID 142967725
2-methyl-1,3-dipropyl-5-(trifluoromethyl)benzene (PubChem CID 142967725) has the molecular formula C14H19F3 and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-methyl-1,3-dipropyl-5-(trifluoromethyl)benzene.
| Compound Name | 2-methyl-1,3-dipropyl-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 142967725 |
| Molecular Formula | C14H19F3 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 2-methyl-1,3-dipropyl-5-(trifluoromethyl)benzene |
| SMILES | CCCc1cc(C(F)(F)F)cc(CCC)c1C |
| InChI | InChI=1S/C14H19F3/c1-4-6-11-8-13(14(15,16)17)9-12(7-5-2)10(11)3/h8-9H,4-7H2,1-3H3 |
| InChIKey | MYDHZEUZBHHUMW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |