C14H19BrF2 — CID 103514641
2-(1-bromo-2,2-difluoroethyl)-1,3,5-triethylbenzene (PubChem CID 103514641) has the molecular formula C14H19BrF2 and a molecular weight of 305.21 g/mol. Its IUPAC name is 2-(1-bromo-2,2-difluoroethyl)-1,3,5-triethylbenzene.
| Compound Name | 2-(1-bromo-2,2-difluoroethyl)-1,3,5-triethylbenzene |
|---|---|
| PubChem CID | 103514641 |
| Molecular Formula | C14H19BrF2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-(1-bromo-2,2-difluoroethyl)-1,3,5-triethylbenzene |
| SMILES | CCc1cc(CC)c(C(Br)C(F)F)c(CC)c1 |
| InChI | InChI=1S/C14H19BrF2/c1-4-9-7-10(5-2)12(11(6-3)8-9)13(15)14(16)17/h7-8,13-14H,4-6H2,1-3H3 |
| InChIKey | HCZMGUJLAIYFLL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|