About 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine
2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine (PubChem CID 82984763) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine.
Molecular Properties
| Compound Name | 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine |
| PubChem CID | 82984763 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine |
| SMILES | CCCC(CCC)C(N)c1c(CC)cc(CC)cc1CC |
| InChI | InChI=1S/C20H35N/c1-6-11-18(12-7-2)20(21)19-16(9-4)13-15(8-3)14-17(19)10-5/h13-14,18,20H,6-12,21H2,1-5H3 |
| InChIKey | SZDDUTWPRWPUMB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine?
The IUPAC name of 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine (CID 82984763) is 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine.
What is the SMILES notation for 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine?
The canonical SMILES for 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine is CCCC(CCC)C(N)c1c(CC)cc(CC)cc1CC.
What is the InChIKey of 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine?
The InChIKey is SZDDUTWPRWPUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N/c1-6-11-18(12-7-2)20(21)19-16(9-4)13-15(8-3)14-17(19)10-5/h13-14,18,20H,6-12,21H2,1-5H3.
What are the key properties of 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine?
2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine has a molecular weight of 289.51 g/mol, XLogP of 5.59, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-1-(2,4,6-triethylphenyl)pentan-1-amine is sourced from PubChem (CID 82984763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).