C27H37O3P — CID 54544995
[methyl-(2,4,6-triethylbenzoyl)phosphoryl]-(2,4,6-triethylphenyl)methanone (PubChem CID 54544995) has the molecular formula C27H37O3P and a molecular weight of 440.56 g/mol. Its IUPAC name is [methyl-(2,4,6-triethylbenzoyl)phosphoryl]-(2,4,6-triethylphenyl)methanone.
| Compound Name | [methyl-(2,4,6-triethylbenzoyl)phosphoryl]-(2,4,6-triethylphenyl)methanone |
|---|---|
| PubChem CID | 54544995 |
| Molecular Formula | C27H37O3P |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | [methyl-(2,4,6-triethylbenzoyl)phosphoryl]-(2,4,6-triethylphenyl)methanone |
| SMILES | CCc1cc(CC)c(C(=O)P(C)(=O)C(=O)c2c(CC)cc(CC)cc2CC)c(CC)c1 |
| InChI | InChI=1S/C27H37O3P/c1-8-18-14-20(10-3)24(21(11-4)15-18)26(28)31(7,30)27(29)25-22(12-5)16-19(9-2)17-23(25)13-6/h14-17H,8-13H2,1-7H3 |
| InChIKey | ZFXBVZBYMRGKMZ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|