C21H26OS — CID 605137
S-(2-phenylethyl) 2,4,6-triethylbenzenecarbothioate (PubChem CID 605137) has the molecular formula C21H26OS and a molecular weight of 326.50 g/mol. Its IUPAC name is S-(2-phenylethyl) 2,4,6-triethylbenzenecarbothioate.
| Compound Name | S-(2-phenylethyl) 2,4,6-triethylbenzenecarbothioate |
|---|---|
| PubChem CID | 605137 |
| Molecular Formula | C21H26OS |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | S-(2-phenylethyl) 2,4,6-triethylbenzenecarbothioate |
| SMILES | CCc1cc(CC)c(C(=O)SCCc2ccccc2)c(CC)c1 |
| InChI | InChI=1S/C21H26OS/c1-4-16-14-18(5-2)20(19(6-3)15-16)21(22)23-13-12-17-10-8-7-9-11-17/h7-11,14-15H,4-6,12-13H2,1-3H3 |
| InChIKey | IHVGYEYKGBPSRB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|