About S-(2-phenylethyl) 2-bromo-2-methylpropanethioate
S-(2-phenylethyl) 2-bromo-2-methylpropanethioate (PubChem CID 71421981) has the molecular formula C12H15BrOS
and a molecular weight of 287.22 g/mol. Its IUPAC name is S-(2-phenylethyl) 2-bromo-2-methylpropanethioate.
Molecular Properties
| Compound Name | S-(2-phenylethyl) 2-bromo-2-methylpropanethioate |
| PubChem CID | 71421981 |
| Molecular Formula | C12H15BrOS |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | S-(2-phenylethyl) 2-bromo-2-methylpropanethioate |
| SMILES | CC(C)(Br)C(=O)SCCc1ccccc1 |
| InChI | InChI=1S/C12H15BrOS/c1-12(2,13)11(14)15-9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | VTLADFXDTCGBSL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-phenylethyl) 2-bromo-2-methylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-phenylethyl) 2-bromo-2-methylpropanethioate?
The IUPAC name of S-(2-phenylethyl) 2-bromo-2-methylpropanethioate (CID 71421981) is S-(2-phenylethyl) 2-bromo-2-methylpropanethioate.
What is the SMILES notation for S-(2-phenylethyl) 2-bromo-2-methylpropanethioate?
The canonical SMILES for S-(2-phenylethyl) 2-bromo-2-methylpropanethioate is CC(C)(Br)C(=O)SCCc1ccccc1.
What is the InChIKey of S-(2-phenylethyl) 2-bromo-2-methylpropanethioate?
The InChIKey is VTLADFXDTCGBSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrOS/c1-12(2,13)11(14)15-9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3.
What are the key properties of S-(2-phenylethyl) 2-bromo-2-methylpropanethioate?
S-(2-phenylethyl) 2-bromo-2-methylpropanethioate has a molecular weight of 287.22 g/mol, XLogP of 3.66, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-phenylethyl) 2-bromo-2-methylpropanethioate is sourced from PubChem (CID 71421981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).