About S-dodecyl 4-phenylbutanethioate
S-dodecyl 4-phenylbutanethioate (PubChem CID 135007295) has the molecular formula C22H36OS
and a molecular weight of 348.60 g/mol. Its IUPAC name is S-dodecyl 4-phenylbutanethioate.
Molecular Properties
| Compound Name | S-dodecyl 4-phenylbutanethioate |
| PubChem CID | 135007295 |
| Molecular Formula | C22H36OS |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | S-dodecyl 4-phenylbutanethioate |
| SMILES | CCCCCCCCCCCCSC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C22H36OS/c1-2-3-4-5-6-7-8-9-10-14-20-24-22(23)19-15-18-21-16-12-11-13-17-21/h11-13,16-17H,2-10,14-15,18-20H2,1H3 |
| InChIKey | WZMQJPRCWKRWGH-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-dodecyl 4-phenylbutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-dodecyl 4-phenylbutanethioate?
The IUPAC name of S-dodecyl 4-phenylbutanethioate (CID 135007295) is S-dodecyl 4-phenylbutanethioate.
What is the SMILES notation for S-dodecyl 4-phenylbutanethioate?
The canonical SMILES for S-dodecyl 4-phenylbutanethioate is CCCCCCCCCCCCSC(=O)CCCc1ccccc1.
What is the InChIKey of S-dodecyl 4-phenylbutanethioate?
The InChIKey is WZMQJPRCWKRWGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36OS/c1-2-3-4-5-6-7-8-9-10-14-20-24-22(23)19-15-18-21-16-12-11-13-17-21/h11-13,16-17H,2-10,14-15,18-20H2,1H3.
What are the key properties of S-dodecyl 4-phenylbutanethioate?
S-dodecyl 4-phenylbutanethioate has a molecular weight of 348.60 g/mol, XLogP of 7.19, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-dodecyl 4-phenylbutanethioate is sourced from PubChem (CID 135007295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).