About S-dodecyl 3-phenylpropanethioate
S-dodecyl 3-phenylpropanethioate (PubChem CID 11493723) has the molecular formula C21H34OS
and a molecular weight of 334.57 g/mol. Its IUPAC name is S-dodecyl 3-phenylpropanethioate.
Molecular Properties
| Compound Name | S-dodecyl 3-phenylpropanethioate |
| PubChem CID | 11493723 |
| Molecular Formula | C21H34OS |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | S-dodecyl 3-phenylpropanethioate |
| SMILES | CCCCCCCCCCCCSC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C21H34OS/c1-2-3-4-5-6-7-8-9-10-14-19-23-21(22)18-17-20-15-12-11-13-16-20/h11-13,15-16H,2-10,14,17-19H2,1H3 |
| InChIKey | KXXYIKKSVLQSOG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-dodecyl 3-phenylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-dodecyl 3-phenylpropanethioate?
The IUPAC name of S-dodecyl 3-phenylpropanethioate (CID 11493723) is S-dodecyl 3-phenylpropanethioate.
What is the SMILES notation for S-dodecyl 3-phenylpropanethioate?
The canonical SMILES for S-dodecyl 3-phenylpropanethioate is CCCCCCCCCCCCSC(=O)CCc1ccccc1.
What is the InChIKey of S-dodecyl 3-phenylpropanethioate?
The InChIKey is KXXYIKKSVLQSOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34OS/c1-2-3-4-5-6-7-8-9-10-14-19-23-21(22)18-17-20-15-12-11-13-16-20/h11-13,15-16H,2-10,14,17-19H2,1H3.
What are the key properties of S-dodecyl 3-phenylpropanethioate?
S-dodecyl 3-phenylpropanethioate has a molecular weight of 334.57 g/mol, XLogP of 6.80, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-dodecyl 3-phenylpropanethioate is sourced from PubChem (CID 11493723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).