C25H27OP — CID 141148656
diphenylphosphanyl-(2,4,6-triethylphenyl)methanone (PubChem CID 141148656) has the molecular formula C25H27OP and a molecular weight of 374.46 g/mol. Its IUPAC name is diphenylphosphanyl-(2,4,6-triethylphenyl)methanone.
| Compound Name | diphenylphosphanyl-(2,4,6-triethylphenyl)methanone |
|---|---|
| PubChem CID | 141148656 |
| Molecular Formula | C25H27OP |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | diphenylphosphanyl-(2,4,6-triethylphenyl)methanone |
| SMILES | CCc1cc(CC)c(C(=O)P(c2ccccc2)c2ccccc2)c(CC)c1 |
| InChI | InChI=1S/C25H27OP/c1-4-19-17-20(5-2)24(21(6-3)18-19)25(26)27(22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-18H,4-6H2,1-3H3 |
| InChIKey | HKDDLFBRQVNUIN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|