C27H22O2P2 — CID 13144216
1,3-bis(diphenylphosphanyl)propane-1,3-dione (PubChem CID 13144216) has the molecular formula C27H22O2P2 and a molecular weight of 440.42 g/mol. Its IUPAC name is 1,3-bis(diphenylphosphanyl)propane-1,3-dione.
| Compound Name | 1,3-bis(diphenylphosphanyl)propane-1,3-dione |
|---|---|
| PubChem CID | 13144216 |
| Molecular Formula | C27H22O2P2 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1,3-bis(diphenylphosphanyl)propane-1,3-dione |
| SMILES | O=C(CC(=O)P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22O2P2/c28-26(30(22-13-5-1-6-14-22)23-15-7-2-8-16-23)21-27(29)31(24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20H,21H2 |
| InChIKey | SCVKIIRWAXEAPG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|