About bis(2-diphenylphosphanylacetic acid);nickel
bis(2-diphenylphosphanylacetic acid);nickel (PubChem CID 156635270) has the molecular formula C28H26NiO4P2
and a molecular weight of 547.15 g/mol. Its IUPAC name is bis(2-diphenylphosphanylacetic acid);nickel.
Molecular Properties
| Compound Name | bis(2-diphenylphosphanylacetic acid);nickel |
| PubChem CID | 156635270 |
| Molecular Formula | C28H26NiO4P2 |
| Molecular Weight | 547.15 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | bis(2-diphenylphosphanylacetic acid);nickel |
| SMILES | O=C(O)CP(c1ccccc1)c1ccccc1.O=C(O)CP(c1ccccc1)c1ccccc1.[Ni] |
| InChI | InChI=1S/2C14H13O2P.Ni/c2*15-14(16)11-17(12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h2*1-10H,11H2,(H,15,16); |
| InChIKey | JAQVFXXESCJPHV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.15 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-diphenylphosphanylacetic acid);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-diphenylphosphanylacetic acid);nickel?
The IUPAC name of bis(2-diphenylphosphanylacetic acid);nickel (CID 156635270) is bis(2-diphenylphosphanylacetic acid);nickel.
What is the SMILES notation for bis(2-diphenylphosphanylacetic acid);nickel?
The canonical SMILES for bis(2-diphenylphosphanylacetic acid);nickel is O=C(O)CP(c1ccccc1)c1ccccc1.O=C(O)CP(c1ccccc1)c1ccccc1.[Ni].
What is the InChIKey of bis(2-diphenylphosphanylacetic acid);nickel?
The InChIKey is JAQVFXXESCJPHV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H13O2P.Ni/c2*15-14(16)11-17(12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h2*1-10H,11H2,(H,15,16);.
What are the key properties of bis(2-diphenylphosphanylacetic acid);nickel?
bis(2-diphenylphosphanylacetic acid);nickel has a molecular weight of 547.15 g/mol, XLogP of 4.41, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-diphenylphosphanylacetic acid);nickel is sourced from PubChem (CID 156635270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).