About diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium
diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium (PubChem CID 87761562) has the molecular formula C25H22P2Ru
and a molecular weight of 485.47 g/mol. Its IUPAC name is diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium.
Molecular Properties
| Compound Name | diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium |
| PubChem CID | 87761562 |
| Molecular Formula | C25H22P2Ru |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium |
| SMILES | [Ru].c1ccc(P(CP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22P2.Ru/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h1-20H,21H2; |
| InChIKey | ULVHEWTXPZTMIY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium?
The IUPAC name of diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium (CID 87761562) is diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium.
What is the SMILES notation for diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium?
The canonical SMILES for diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium is [Ru].c1ccc(P(CP(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium?
The InChIKey is ULVHEWTXPZTMIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22P2.Ru/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h1-20H,21H2;.
What are the key properties of diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium?
diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium has a molecular weight of 485.47 g/mol, XLogP of 5.21, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphanylmethyl(diphenyl)phosphane;ruthenium is sourced from PubChem (CID 87761562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).